CAS 2385790-40-7 is the registry number for 3-Chloro-5-hydroxy-4-iodobenzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-5-hydroxy-4-iodobenzamide (CAS 2385790-40-7) is a chemical compound with the molecular formula C7H5ClINO2 and a molecular weight of 297.48 g/mol. IUPAC name: 3-chloro-5-hydroxy-4-iodobenzamide. InChIKey: VDGWWQMYDGHEJK-UHFFFAOYSA-N.
| Molecular formula | C7H5ClINO2 |
|---|---|
| Molecular weight | 297.48 g/mol |
| IUPAC name | 3-chloro-5-hydroxy-4-iodobenzamide |
| InChIKey | VDGWWQMYDGHEJK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)I)Cl)C(=O)N |
Computed by PubChem (NCBI)