CAS 2386160-27-4 appears in our catalog under these names: 2-Bromo-4-(tert-butyl)-6-chloroaniline, 95%, 2-bromo-4-(tert-butyl)-6-chloroaniline, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1g, 50g.
2-bromo-4-tert-butyl-6-chloroaniline (CAS 2386160-27-4) is a chemical compound with the molecular formula C10H13BrClN and a molecular weight of 262.57 g/mol. IUPAC name: 2-bromo-4-tert-butyl-6-chloroaniline. InChIKey: VDTYTMRQVBICKX-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClN |
|---|---|
| Molecular weight | 262.57 g/mol |
| IUPAC name | 2-bromo-4-tert-butyl-6-chloroaniline |
| InChIKey | VDTYTMRQVBICKX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)Br)N)Cl |
Computed by PubChem (NCBI)