CAS 2386471-96-9 is the registry number for 3-methoxy-2-methyl-4-nitrophenol, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-methoxy-2-methyl-4-nitrophenol (CAS 2386471-96-9) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 3-methoxy-2-methyl-4-nitrophenol. InChIKey: MTCKPUCLOLTFMY-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 3-methoxy-2-methyl-4-nitrophenol |
| InChIKey | MTCKPUCLOLTFMY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1OC)[N+](=O)[O-])O |
Computed by PubChem (NCBI)