CAS 2386741-45-1 is the registry number for tert-Butyl 2,4-difluoro-3,3-dihydroxy-8-azabicyclo(3.2.1)octane-8-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl 2-fluoro-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate;hydrate (CAS 2386741-45-1) is a chemical compound with the molecular formula C12H20FNO4 and a molecular weight of 261.29 g/mol. IUPAC name: tert-butyl 2-fluoro-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate;hydrate. InChIKey: DKMUZQIQDZLIMK-UHFFFAOYSA-N.
| Molecular formula | C12H20FNO4 |
|---|---|
| Molecular weight | 261.29 g/mol |
| IUPAC name | tert-butyl 2-fluoro-3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate;hydrate |
| InChIKey | DKMUZQIQDZLIMK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1C(C(=O)C2)F.O |
Computed by PubChem (NCBI)