Products 1303974-48-2

CAS 1303974-48-2 is the registry number for 1-tert-Butyl 4-methyl 3-fluoropiperidine-1,4-dicarboxylate, 97%. Offered by: AmBeed. Available pack sizes: 250mg.

1-O-tert-butyl 4-O-methyl 3-fluoropiperidine-1,4-dicarboxylate (CAS 1303974-48-2) is a chemical compound with the molecular formula C12H20FNO4 and a molecular weight of 261.29 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 3-fluoropiperidine-1,4-dicarboxylate. InChIKey: YUFJCQYJBJXLJH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20FNO4
Molecular weight261.29 g/mol
IUPAC name1-O-tert-butyl 4-O-methyl 3-fluoropiperidine-1,4-dicarboxylate
InChIKeyYUFJCQYJBJXLJH-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(C(C1)F)C(=O)OC

Computed by PubChem (NCBI)