Products 2611481-68-4
CAS 2611481-68-4 is the registry number for (R)-2-((tert-Butoxycarbonyl)amino)-2-(3-fluoro-3-methylcyclobutyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(3-fluoro-3-methylcyclobutyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 2611481-68-4) is a chemical compound with the molecular formula C12H20FNO4 and a molecular weight of 261.29 g/mol. IUPAC name: (2R)-2-(3-fluoro-3-methylcyclobutyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: NBLRTVSFQKURKU-UWZOBUBJSA-N.
| Molecular formula | C12H20FNO4 |
|---|---|
| Molecular weight | 261.29 g/mol |
| IUPAC name | (2R)-2-(3-fluoro-3-methylcyclobutyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | NBLRTVSFQKURKU-UWZOBUBJSA-N |
| SMILES | CC1(CC(C1)[C@H](C(=O)O)NC(=O)OC(C)(C)C)F |
Computed by PubChem (NCBI)