CAS 1904019-50-6 is the registry number for cis-1-tert-Butyl 4-methyl 3-fluoropiperidine-1,4-dicarboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
1-O-tert-butyl 4-O-methyl (3R,4S)-3-fluoropiperidine-1,4-dicarboxylate (CAS 1904019-50-6) is a chemical compound with the molecular formula C12H20FNO4 and a molecular weight of 261.29 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl (3R,4S)-3-fluoropiperidine-1,4-dicarboxylate. InChIKey: YUFJCQYJBJXLJH-BDAKNGLRSA-N.
| Molecular formula | C12H20FNO4 |
|---|---|
| Molecular weight | 261.29 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl (3R,4S)-3-fluoropiperidine-1,4-dicarboxylate |
| InChIKey | YUFJCQYJBJXLJH-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@H](C1)F)C(=O)OC |
Computed by PubChem (NCBI)