CAS 1984825-19-5 appears in our catalog under these names: (2S,4R,5S)-1-tert-Butyl 2-methyl 4-fluoro-5-methylpyrrolidine-1,2-dicarboxylate, 97%, 1–(tert–Butyl) 2–methyl (2S,4R,5S)–4–fluoro–5–methylpyrrolidine–1,2–dicarboxylate. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 1g.
1-O-tert-butyl 2-O-methyl (2S,4R,5S)-4-fluoro-5-methylpyrrolidine-1,2-dicarboxylate (CAS 1984825-19-5) is a chemical compound with the molecular formula C12H20FNO4 and a molecular weight of 261.29 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4R,5S)-4-fluoro-5-methylpyrrolidine-1,2-dicarboxylate. InChIKey: DWKRYBXQNLRIKM-YIZRAAEISA-N.
| Molecular formula | C12H20FNO4 |
|---|---|
| Molecular weight | 261.29 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4R,5S)-4-fluoro-5-methylpyrrolidine-1,2-dicarboxylate |
| InChIKey | DWKRYBXQNLRIKM-YIZRAAEISA-N |
| SMILES | C[C@H]1[C@@H](C[C@H](N1C(=O)OC(C)(C)C)C(=O)OC)F |
Computed by PubChem (NCBI)