Products 2386818-11-5
CAS 2386818-11-5 is the registry number for 5-Methylquinoline-3-carboxylic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
5-methylquinoline-3-carboxylic acid (CAS 2386818-11-5) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 5-methylquinoline-3-carboxylic acid. InChIKey: GZWILZHJJPXANM-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 5-methylquinoline-3-carboxylic acid |
| InChIKey | GZWILZHJJPXANM-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C=NC2=CC=C1)C(=O)O |
Computed by PubChem (NCBI)