Products 2386829-95-2
CAS 2386829-95-2 is the registry number for tert-butyl (imino(thiazol-2-yl)methyl)carbamate, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl N-(1,3-thiazole-2-carboximidoyl)carbamate (CAS 2386829-95-2) is a chemical compound with the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. IUPAC name: tert-butyl N-(1,3-thiazole-2-carboximidoyl)carbamate. InChIKey: BJYCKMFPGDMOHL-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O2S |
|---|---|
| Molecular weight | 227.29 g/mol |
| IUPAC name | tert-butyl N-(1,3-thiazole-2-carboximidoyl)carbamate |
| InChIKey | BJYCKMFPGDMOHL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(=N)C1=NC=CS1 |
Computed by PubChem (NCBI)