Products 2387367-62-4
CAS 2387367-62-4 is the registry number for 6-fluoro-3-formyl-2-methoxybenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-fluoro-3-formyl-2-methoxybenzoic acid (CAS 2387367-62-4) is a chemical compound with the molecular formula C9H7FO4 and a molecular weight of 198.15 g/mol. IUPAC name: 6-fluoro-3-formyl-2-methoxybenzoic acid. InChIKey: WMSVLKTTYJUSHZ-UHFFFAOYSA-N.
| Molecular formula | C9H7FO4 |
|---|---|
| Molecular weight | 198.15 g/mol |
| IUPAC name | 6-fluoro-3-formyl-2-methoxybenzoic acid |
| InChIKey | WMSVLKTTYJUSHZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1C(=O)O)F)C=O |
Computed by PubChem (NCBI)
Synonyms:
6-fluoro-3-formyl-2-methoxybenzoic acid