CAS 2387602-02-8 appears in our catalog under these names: 3-(3-(Trifluoromethyl)phenyl)azetidin-3-ol hydrochloride, 97%, 3-[3-(trifluoromethyl)phenyl]azetidin-3-ol hydrochloride, 97%, 97%, 3-Azetidinol, 3-[3-(trifluoromethyl)phenyl]-, hydrochloride (1:1), 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
3-[3-(trifluoromethyl)phenyl]azetidin-3-ol;hydrochloride (CAS 2387602-02-8) is a chemical compound with the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenyl]azetidin-3-ol;hydrochloride. InChIKey: BGIGDRPUPXLGII-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO |
|---|---|
| Molecular weight | 253.65 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)phenyl]azetidin-3-ol;hydrochloride |
| InChIKey | BGIGDRPUPXLGII-UHFFFAOYSA-N |
| SMILES | C1C(CN1)(C2=CC(=CC=C2)C(F)(F)F)O.Cl |
Computed by PubChem (NCBI)