CAS 2388985-31-5 is the registry number for Ethyl (1R,2R)-2-(3-bromophenyl)cyclopropane-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Trans-ethyl (1R,2R)-2-(3-bromophenyl)cyclopropane-1-carboxylate (CAS 2388985-31-5) is a chemical compound with the molecular formula C12H13BrO2 and a molecular weight of 269.13 g/mol. IUPAC name: trans-ethyl (1R,2R)-2-(3-bromophenyl)cyclopropane-1-carboxylate. InChIKey: FICVJKZHLQIKGN-WDEREUQCSA-N.
| Molecular formula | C12H13BrO2 |
|---|---|
| Molecular weight | 269.13 g/mol |
| IUPAC name | trans-ethyl (1R,2R)-2-(3-bromophenyl)cyclopropane-1-carboxylate |
| InChIKey | FICVJKZHLQIKGN-WDEREUQCSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@H]1C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)