Products 239-13-4
CAS 239-13-4 is the registry number for Antiproliferative agent-38. Offered by: MedChemExpress. Available pack sizes: Get quote.
11H-pyrido[2,3-a]carbazole (CAS 239-13-4) is a chemical compound with the molecular formula C15H10N2 and a molecular weight of 218.25 g/mol. IUPAC name: 11H-pyrido[2,3-a]carbazole. InChIKey: LHKWAXPYLUZMHY-UHFFFAOYSA-N.
| Molecular formula | C15H10N2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 11H-pyrido[2,3-a]carbazole |
| InChIKey | LHKWAXPYLUZMHY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C4=C(C=CC=N4)C=C3 |
Computed by PubChem (NCBI)