Products 239135-34-3
CAS 239135-34-3 is the registry number for Glutamate, caged hydrate. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
(2S)-2-amino-5-hydroxy-5-oxopentanoate (CAS 239135-34-3) is a chemical compound with the molecular formula C5H8NO4- and a molecular weight of 146.12 g/mol. IUPAC name: (2S)-2-amino-5-hydroxy-5-oxopentanoate. InChIKey: WHUUTDBJXJRKMK-VKHMYHEASA-M.
| Molecular formula | C5H8NO4- |
|---|---|
| Molecular weight | 146.12 g/mol |
| IUPAC name | (2S)-2-amino-5-hydroxy-5-oxopentanoate |
| InChIKey | WHUUTDBJXJRKMK-VKHMYHEASA-M |
| SMILES | C(CC(=O)O)[C@@H](C(=O)[O-])N |
Computed by PubChem (NCBI)