CAS 23947-41-3 appears in our catalog under these names: 5,8-Dimethoxy-4-methyl-2(1h)-quinolinone, 95%, 5,8-Dimethoxy-4-methylquinolin-2-ol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5,8-dimethoxy-4-methyl-1H-quinolin-2-one (CAS 23947-41-3) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 5,8-dimethoxy-4-methyl-1H-quinolin-2-one. InChIKey: BUHDAIGNGIXQJO-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 5,8-dimethoxy-4-methyl-1H-quinolin-2-one |
| InChIKey | BUHDAIGNGIXQJO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC2=C(C=CC(=C12)OC)OC |
Computed by PubChem (NCBI)