Products 2396429-29-9
CAS 2396429-29-9 is the registry number for 1-(tert-Butyl) 3-methyl (R)-tetrahydropyridazine-1,3(2H)-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 3-O-methyl (3R)-diazinane-1,3-dicarboxylate (CAS 2396429-29-9) is a chemical compound with the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3R)-diazinane-1,3-dicarboxylate. InChIKey: GTNRUQYZGVYAAM-MRVPVSSYSA-N.
| Molecular formula | C11H20N2O4 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3R)-diazinane-1,3-dicarboxylate |
| InChIKey | GTNRUQYZGVYAAM-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](N1)C(=O)OC |
Computed by PubChem (NCBI)