Products 503177-95-5
CAS 503177-95-5 appears in our catalog under these names: 1-(tert-Butyl) 3-methyl (S)-tetrahydropyridazine-1,3(2H)-dicarboxylate, 95%, 95%, 1-(tert-Butyl) 3-methyl (S)-tetrahydropyridazine-1,3(2H)-dicarboxylate, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-O-tert-butyl 3-O-methyl (3S)-diazinane-1,3-dicarboxylate (CAS 503177-95-5) is a chemical compound with the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3S)-diazinane-1,3-dicarboxylate. InChIKey: GTNRUQYZGVYAAM-QMMMGPOBSA-N.
| Molecular formula | C11H20N2O4 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3S)-diazinane-1,3-dicarboxylate |
| InChIKey | GTNRUQYZGVYAAM-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](N1)C(=O)OC |
Computed by PubChem (NCBI)