CAS 240122-24-1 appears in our catalog under these names: 2,3–Difluoro–4–(trifluoromethyl)benzonitrile, 2,3-Difluoro-4-(trifluoromethyl)benzonitrile 98%, 2,3-Difluoro-4-(trifluoromethyl)benzonitrile, 98%, 98%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,3-difluoro-4-(trifluoromethyl)benzonitrile (CAS 240122-24-1) is a chemical compound with the molecular formula C8H2F5N and a molecular weight of 207.10 g/mol. IUPAC name: 2,3-difluoro-4-(trifluoromethyl)benzonitrile. InChIKey: FBNHHKLZBCDJQU-UHFFFAOYSA-N.
| Molecular formula | C8H2F5N |
|---|---|
| Molecular weight | 207.10 g/mol |
| IUPAC name | 2,3-difluoro-4-(trifluoromethyl)benzonitrile |
| InChIKey | FBNHHKLZBCDJQU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C#N)F)F)C(F)(F)F |
Computed by PubChem (NCBI)