Products 24016-48-6
CAS 24016-48-6 is the registry number for L-Glutamic acid-14C. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-amino(514C)pentanedioic acid (CAS 24016-48-6) is a chemical compound with the molecular formula C5H9NO4 and a molecular weight of 149.12 g/mol. IUPAC name: (2S)-2-amino(514C)pentanedioic acid. InChIKey: WHUUTDBJXJRKMK-QZFAVJRCSA-N.
| Molecular formula | C5H9NO4 |
|---|---|
| Molecular weight | 149.12 g/mol |
| IUPAC name | (2S)-2-amino(514C)pentanedioic acid |
| InChIKey | WHUUTDBJXJRKMK-QZFAVJRCSA-N |
| SMILES | C(C[14C](=O)O)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)