CAS 2402-72-4 appears in our catalog under these names: 2-(4-Bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol, 2-(4-Bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol, 98%, 2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoro-2-propanol, 98%, 98%. Offered by: Biosynth, Fluorochem, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g, 5g.
2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (CAS 2402-72-4) is a chemical compound with the molecular formula C9H5BrF6O and a molecular weight of 323.03 g/mol. IUPAC name: 2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol. InChIKey: PRQQUQLCNCIJTF-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF6O |
|---|---|
| Molecular weight | 323.03 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| InChIKey | PRQQUQLCNCIJTF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)(C(F)(F)F)O)Br |
Computed by PubChem (NCBI)