CAS 240423-23-8 appears in our catalog under these names: 8-(3,4-Dihydroxy-4-methylpentyl)-3-isopropyl-7-methylnaphthalene-1,2-dione, Salvicine. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
8-(3,4-dihydroxy-4-methylpentyl)-7-methyl-3-propan-2-ylnaphthalene-1,2-dione (CAS 240423-23-8) is a chemical compound with the molecular formula C20H26O4 and a molecular weight of 330.4 g/mol. IUPAC name: 8-(3,4-dihydroxy-4-methylpentyl)-7-methyl-3-propan-2-ylnaphthalene-1,2-dione. InChIKey: NZIUPDOWWMGNCV-UHFFFAOYSA-N.
| Molecular formula | C20H26O4 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 8-(3,4-dihydroxy-4-methylpentyl)-7-methyl-3-propan-2-ylnaphthalene-1,2-dione |
| InChIKey | NZIUPDOWWMGNCV-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C=C(C(=O)C2=O)C(C)C)CCC(C(C)(C)O)O |
Computed by PubChem (NCBI)