CAS 2407819-94-5 appears in our catalog under these names: Fmoc-MeAla(cBu)-OH 95%, (2S)-3-cyclobutyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}(methyl)amino)propanoic acid, 98%, 98%, Fmoc-N-methyl-(S)-3-Cyclobutylalanine, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2S)-3-cyclobutyl-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid (CAS 2407819-94-5) is a chemical compound with the molecular formula C23H25NO4 and a molecular weight of 379.4 g/mol. IUPAC name: (2S)-3-cyclobutyl-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid. InChIKey: VRPXUVWVESGNRD-NRFANRHFSA-N.
| Molecular formula | C23H25NO4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | (2S)-3-cyclobutyl-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid |
| InChIKey | VRPXUVWVESGNRD-NRFANRHFSA-N |
| SMILES | CN([C@@H](CC1CCC1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)