Products 2409181-68-4
CAS 2409181-68-4 is the registry number for rel-(3R,5S)-1-(tert-butoxycarbonyl)-5-phenylpyrrolidine-3-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(3S,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-phenylpyrrolidine-3-carboxylic acid (CAS 2409181-68-4) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: (3S,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-phenylpyrrolidine-3-carboxylic acid. InChIKey: YOQSWKMNZBOUGT-QWHCGFSZSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | (3S,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-phenylpyrrolidine-3-carboxylic acid |
| InChIKey | YOQSWKMNZBOUGT-QWHCGFSZSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)