Products 2409918-52-9
CAS 2409918-52-9 is the registry number for tert-Butyl 2-((2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)oxy)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetate (CAS 2409918-52-9) is a chemical compound with the molecular formula C20H22N2O7 and a molecular weight of 402.4 g/mol. IUPAC name: tert-butyl 2-[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetate. InChIKey: BQXWHMQBKJAZDP-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O7 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | tert-butyl 2-[2-(1-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyacetate |
| InChIKey | BQXWHMQBKJAZDP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COC1=CC=CC2=C1C(=O)N(C2=O)C3CCC(=O)N(C3=O)C |
Computed by PubChem (NCBI)