CAS 2169266-69-5 appears in our catalog under these names: Thalidomide 4'–ether–alkylC6–acid, Thalidomide-O-C6-COOH 95%, Thalidomide-O-C6-COOH, 95%, 95%, Thalidomide-O-C6-COOH, 99.29%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 50 mg, 100 mg, 5 mg.
7-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyheptanoic acid (CAS 2169266-69-5) is a chemical compound with the molecular formula C20H22N2O7 and a molecular weight of 402.4 g/mol. IUPAC name: 7-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyheptanoic acid. InChIKey: BATNDOUDCIVVSL-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O7 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | 7-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyheptanoic acid |
| InChIKey | BATNDOUDCIVVSL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)OCCCCCCC(=O)O |
Computed by PubChem (NCBI)