Products 20448-71-9
CAS 20448-71-9 is the registry number for Z-Tyr-Ser-OH. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg, 250mg, 500mg.
(2S)-3-hydroxy-2-[[(2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid (CAS 20448-71-9) is a chemical compound with the molecular formula C20H22N2O7 and a molecular weight of 402.4 g/mol. IUPAC name: (2S)-3-hydroxy-2-[[(2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid. InChIKey: LZMMFOXOCHALJU-IRXDYDNUSA-N.
| Molecular formula | C20H22N2O7 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | (2S)-3-hydroxy-2-[[(2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid |
| InChIKey | LZMMFOXOCHALJU-IRXDYDNUSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)N[C@@H](CO)C(=O)O |
Computed by PubChem (NCBI)