CAS 20866-55-1 appears in our catalog under these names: Boc-Tyr-Onp, 96%, Boc-Tyr-ONp, 98%, Boc–Tyr–ONp. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100g, 5g, 25g, 1g.
(4-nitrophenyl) (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 20866-55-1) is a chemical compound with the molecular formula C20H22N2O7 and a molecular weight of 402.4 g/mol. IUPAC name: (4-nitrophenyl) (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: BNBKZMYOTFMWHX-KRWDZBQOSA-N.
| Molecular formula | C20H22N2O7 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | BNBKZMYOTFMWHX-KRWDZBQOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)