CAS 82219-48-5 appears in our catalog under these names: Nimodipine Impurity 7, Nimodipine Impurity 28, Nimodipine Metabolite 3. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
5-O-(2-hydroxyethyl) 3-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate (CAS 82219-48-5) is a chemical compound with the molecular formula C20H22N2O7 and a molecular weight of 402.4 g/mol. IUPAC name: 5-O-(2-hydroxyethyl) 3-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate. InChIKey: PWPBMCUBOQNEJD-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O7 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | 5-O-(2-hydroxyethyl) 3-O-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate |
| InChIKey | PWPBMCUBOQNEJD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)C(=O)OC(C)C)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OCCO |
Computed by PubChem (NCBI)