CAS 2410955-47-2 appears in our catalog under these names: Rel-1-(tert-butyl) 3-ethyl (3R,4R)-4-aminopiperidine-1,3-dicarboxylate, 98%, trans-1-Boc-4-amino-piperidine-3-carboxylic acid ethyl ester hydrochloride. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg.
1-O-tert-butyl 3-O-ethyl (3R,4R)-4-aminopiperidine-1,3-dicarboxylate (CAS 2410955-47-2) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3R,4R)-4-aminopiperidine-1,3-dicarboxylate. InChIKey: ORRVKLSXTZZGJV-NXEZZACHSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3R,4R)-4-aminopiperidine-1,3-dicarboxylate |
| InChIKey | ORRVKLSXTZZGJV-NXEZZACHSA-N |
| SMILES | CCOC(=O)[C@@H]1CN(CC[C@H]1N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)