CAS 264229-35-8 appears in our catalog under these names: Rel-1-(tert-butyl) 3-ethyl (3R,4S)-4-aminopiperidine-1,3-dicarboxylate, 97%, rac-(3R,4S)-1-tert-Butyl 3-ethyl 4-aminopiperidine-1,3-dicarboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 2,5g, 250mg.
1-O-tert-butyl 3-O-ethyl (3R,4S)-4-aminopiperidine-1,3-dicarboxylate (CAS 264229-35-8) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3R,4S)-4-aminopiperidine-1,3-dicarboxylate. InChIKey: ORRVKLSXTZZGJV-ZJUUUORDSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3R,4S)-4-aminopiperidine-1,3-dicarboxylate |
| InChIKey | ORRVKLSXTZZGJV-ZJUUUORDSA-N |
| SMILES | CCOC(=O)[C@@H]1CN(CC[C@@H]1N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)