CAS 859855-31-5 appears in our catalog under these names: 1-tert-butyl 3-ethyl (3S,4R)-4-aminopiperidine-1,3-dicarboxylate, 97%, 97%, 1-(tert-Butyl) 3-ethyl (3S,4R)-4-aminopiperidine-1,3-dicarboxylate, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-O-tert-butyl 3-O-ethyl (3S,4R)-4-aminopiperidine-1,3-dicarboxylate (CAS 859855-31-5) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3S,4R)-4-aminopiperidine-1,3-dicarboxylate. InChIKey: ORRVKLSXTZZGJV-VHSXEESVSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3S,4R)-4-aminopiperidine-1,3-dicarboxylate |
| InChIKey | ORRVKLSXTZZGJV-VHSXEESVSA-N |
| SMILES | CCOC(=O)[C@H]1CN(CC[C@H]1N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)