Products 2411099-30-2
CAS 2411099-30-2 is the registry number for TRβ agonist 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-[(4-acetamido-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenoxy]acetic acid (CAS 2411099-30-2) is a chemical compound with the molecular formula C22H27NO4 and a molecular weight of 369.5 g/mol. IUPAC name: 2-[4-[(4-acetamido-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenoxy]acetic acid. InChIKey: GZHDROJXCQEXMK-UHFFFAOYSA-N.
| Molecular formula | C22H27NO4 |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | 2-[4-[(4-acetamido-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenoxy]acetic acid |
| InChIKey | GZHDROJXCQEXMK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1CC2=CC(=C(C=C2)NC(=O)C)C(C)C)C)OCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
TR|A agonist 2, orb1688571