Products 2411108-21-7
CAS 2411108-21-7 is the registry number for Anticancer agent 235. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-chloro-8-methoxy-5-methylindolo[2,3-b]quinoline (CAS 2411108-21-7) is a chemical compound with the molecular formula C17H13ClN2O and a molecular weight of 296.7 g/mol. IUPAC name: 2-chloro-8-methoxy-5-methylindolo[2,3-b]quinoline. InChIKey: RJKACWUBQPTQCW-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O |
|---|---|
| Molecular weight | 296.7 g/mol |
| IUPAC name | 2-chloro-8-methoxy-5-methylindolo[2,3-b]quinoline |
| InChIKey | RJKACWUBQPTQCW-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Cl)C=C3C1=NC4=C3C=CC(=C4)OC |
Computed by PubChem (NCBI)
Synonyms:
Anticancer agent 235, orb2646364