CAS 2411177-85-8 is the registry number for tert-Butyl (3aR,6aS)-3-oxohexahydrocyclopenta[b]pyrrole-1(2H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3aR,6aS)-3-oxo-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxylate (CAS 2411177-85-8) is a chemical compound with the molecular formula C12H19NO3 and a molecular weight of 225.28 g/mol. IUPAC name: tert-butyl (3aR,6aS)-3-oxo-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxylate. InChIKey: JOCXFHAYSWYBDR-BDAKNGLRSA-N.
| Molecular formula | C12H19NO3 |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | tert-butyl (3aR,6aS)-3-oxo-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-1-carboxylate |
| InChIKey | JOCXFHAYSWYBDR-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)[C@H]2[C@@H]1CCC2 |
Computed by PubChem (NCBI)