Products 241127-61-7
CAS 241127-61-7 is the registry number for ALR-38. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 4-[(1,4-dihydroxynaphthalen-2-yl)methylamino]benzoate (CAS 241127-61-7) is a chemical compound with the molecular formula C19H17NO4 and a molecular weight of 323.3 g/mol. IUPAC name: methyl 4-[(1,4-dihydroxynaphthalen-2-yl)methylamino]benzoate. InChIKey: VCIGMSXFBWIQPP-UHFFFAOYSA-N.
| Molecular formula | C19H17NO4 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | methyl 4-[(1,4-dihydroxynaphthalen-2-yl)methylamino]benzoate |
| InChIKey | VCIGMSXFBWIQPP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)NCC2=C(C3=CC=CC=C3C(=C2)O)O |
Computed by PubChem (NCBI)