Products 35957-29-0

CAS 35957-29-0 is the registry number for 6-Benzyloxy-4-hydroxy-quinoline-3-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 4-oxo-6-phenylmethoxy-1H-quinoline-3-carboxylate (CAS 35957-29-0) is a chemical compound with the molecular formula C19H17NO4 and a molecular weight of 323.3 g/mol. IUPAC name: ethyl 4-oxo-6-phenylmethoxy-1H-quinoline-3-carboxylate. InChIKey: DJEWCFRESDPGKV-UHFFFAOYSA-N.

Identity
Molecular formulaC19H17NO4
Molecular weight323.3 g/mol
IUPAC nameethyl 4-oxo-6-phenylmethoxy-1H-quinoline-3-carboxylate
InChIKeyDJEWCFRESDPGKV-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CNC2=C(C1=O)C=C(C=C2)OCC3=CC=CC=C3

Computed by PubChem (NCBI)