Products 438212-28-3
CAS 438212-28-3 appears in our catalog under these names: 2-(2,5-Dimethoxyphenyl)-6-methylquinoline-4-carboxylic acid, 95%, 2-(2,5-Dimethoxyphenyl)-6-methylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(2,5-dimethoxyphenyl)-6-methylquinoline-4-carboxylic acid (CAS 438212-28-3) is a chemical compound with the molecular formula C19H17NO4 and a molecular weight of 323.3 g/mol. IUPAC name: 2-(2,5-dimethoxyphenyl)-6-methylquinoline-4-carboxylic acid. InChIKey: RRSNSXSYRRRCNC-UHFFFAOYSA-N.
| Molecular formula | C19H17NO4 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | 2-(2,5-dimethoxyphenyl)-6-methylquinoline-4-carboxylic acid |
| InChIKey | RRSNSXSYRRRCNC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C=C2C(=O)O)C3=C(C=CC(=C3)OC)OC |
Computed by PubChem (NCBI)