CAS 184763-07-3 appears in our catalog under these names: 1-Fmoc-2-azetidinecarboxylic acid, 95%, 1-(((9H-Fluoren-9-yl)methoxy)carbonyl)azetidine-2-carboxylic acid, 95%, 1-Fmoc-2-azetidinecarboxylic acid, 1-(((9H-fluoren-9-yl)methoxy)carbonyl)azetidine-2-carboxylic acid, 98%, 98%, 1-FMOC-2-AZETIDINECARBOXYLIC ACID, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 2,5g.
1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid (CAS 184763-07-3) is a chemical compound with the molecular formula C19H17NO4 and a molecular weight of 323.3 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid. InChIKey: BXRZCDISGRVJCA-UHFFFAOYSA-N.
| Molecular formula | C19H17NO4 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid |
| InChIKey | BXRZCDISGRVJCA-UHFFFAOYSA-N |
| SMILES | C1CN(C1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)