Products 2411302-44-6
CAS 2411302-44-6 is the registry number for Ethyl 6,7-dimethyl-5-oxo-5,6-dihydro-1,6-naphthyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 6,7-dimethyl-5-oxo-1,6-naphthyridine-2-carboxylate (CAS 2411302-44-6) is a chemical compound with the molecular formula C13H14N2O3 and a molecular weight of 246.26 g/mol. IUPAC name: ethyl 6,7-dimethyl-5-oxo-1,6-naphthyridine-2-carboxylate. InChIKey: APVDCVHDLGQRFL-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O3 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | ethyl 6,7-dimethyl-5-oxo-1,6-naphthyridine-2-carboxylate |
| InChIKey | APVDCVHDLGQRFL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(C=C1)C(=O)N(C(=C2)C)C |
Computed by PubChem (NCBI)