CAS 2411591-91-6 appears in our catalog under these names: (R)-1-(6-chloropyridin-3-yl)ethan-1-amine dihydrochloride, 98%, 98%, (R)-1-(6-CHLOROPYRIDIN-3-YL)ETHANAMINE DIHYDROCHLORIDE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1R)-1-(6-chloro-3-pyridinyl)ethanamine;dihydrochloride (CAS 2411591-91-6) is a chemical compound with the molecular formula C7H11Cl3N2 and a molecular weight of 229.5 g/mol. IUPAC name: (1R)-1-(6-chloro-3-pyridinyl)ethanamine;dihydrochloride. InChIKey: LNWIEMNNGWWHTM-ZJIMSODOSA-N.
| Molecular formula | C7H11Cl3N2 |
|---|---|
| Molecular weight | 229.5 g/mol |
| IUPAC name | (1R)-1-(6-chloro-3-pyridinyl)ethanamine;dihydrochloride |
| InChIKey | LNWIEMNNGWWHTM-ZJIMSODOSA-N |
| SMILES | C[C@H](C1=CN=C(C=C1)Cl)N.Cl.Cl |
Computed by PubChem (NCBI)