Products 2411819-12-8
CAS 2411819-12-8 is the registry number for 5-(5-chloropyridin-2-yl)-1H-pyrrole-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
5-(5-chloro-2-pyridinyl)-1H-pyrrole-2-carboxylic acid (CAS 2411819-12-8) is a chemical compound with the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. IUPAC name: 5-(5-chloro-2-pyridinyl)-1H-pyrrole-2-carboxylic acid. InChIKey: ITHDBAQDPYMEQV-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2 |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | 5-(5-chloro-2-pyridinyl)-1H-pyrrole-2-carboxylic acid |
| InChIKey | ITHDBAQDPYMEQV-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)C2=CC=C(N2)C(=O)O |
Computed by PubChem (NCBI)