Products 2413233-68-6
CAS 2413233-68-6 is the registry number for Fmoc-D-Nle(6-OH)-OH. Offered by: Iris Biotech. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-hydroxyhexanoic acid (CAS 2413233-68-6) is a chemical compound with the molecular formula C21H23NO5 and a molecular weight of 369.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-hydroxyhexanoic acid. InChIKey: RLKMUBZYLZBKMO-LJQANCHMSA-N.
| Molecular formula | C21H23NO5 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-hydroxyhexanoic acid |
| InChIKey | RLKMUBZYLZBKMO-LJQANCHMSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCCCO)C(=O)O |
Computed by PubChem (NCBI)