CAS 2413694-58-1 is the registry number for tert-Butyl 4-chloro-3-methoxypicolinate, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 4-chloro-3-methoxypyridine-2-carboxylate (CAS 2413694-58-1) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: tert-butyl 4-chloro-3-methoxypyridine-2-carboxylate. InChIKey: LMAYCQHMHCHCTL-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO3 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | tert-butyl 4-chloro-3-methoxypyridine-2-carboxylate |
| InChIKey | LMAYCQHMHCHCTL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=NC=CC(=C1OC)Cl |
Computed by PubChem (NCBI)