Products 2414485-98-4
CAS 2414485-98-4 is the registry number for 4-Chloro-N-methyl-N-(3,3,3-trifluoropropyl)aniline, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-chloro-N-methyl-N-(3,3,3-trifluoropropyl)aniline (CAS 2414485-98-4) is a chemical compound with the molecular formula C10H11ClF3N and a molecular weight of 237.65 g/mol. IUPAC name: 4-chloro-N-methyl-N-(3,3,3-trifluoropropyl)aniline. InChIKey: UEEFDZLQKXEKSS-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3N |
|---|---|
| Molecular weight | 237.65 g/mol |
| IUPAC name | 4-chloro-N-methyl-N-(3,3,3-trifluoropropyl)aniline |
| InChIKey | UEEFDZLQKXEKSS-UHFFFAOYSA-N |
| SMILES | CN(CCC(F)(F)F)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)