Products 2414629-82-4
CAS 2414629-82-4 is the registry number for hCAIX/XII-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-methyl-7-[(5-phenyl-1,2,4-oxadiazol-3-yl)methoxy]chromen-2-one (CAS 2414629-82-4) is a chemical compound with the molecular formula C19H14N2O4 and a molecular weight of 334.3 g/mol. IUPAC name: 4-methyl-7-[(5-phenyl-1,2,4-oxadiazol-3-yl)methoxy]chromen-2-one. InChIKey: IIRFKVBIPSSOHC-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O4 |
|---|---|
| Molecular weight | 334.3 g/mol |
| IUPAC name | 4-methyl-7-[(5-phenyl-1,2,4-oxadiazol-3-yl)methoxy]chromen-2-one |
| InChIKey | IIRFKVBIPSSOHC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OCC3=NOC(=N3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
hCAIX/XII-IN-2, orb1689022