Products 2415998-36-4
CAS 2415998-36-4 is the registry number for NMDA receptor antagonist 5. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R,9S,11R)-11-(4-bromophenyl)-10-oxa-15-azatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6-trien-14-one (CAS 2415998-36-4) is a chemical compound with the molecular formula C19H16BrNO2 and a molecular weight of 370.2 g/mol. IUPAC name: (1R,9S,11R)-11-(4-bromophenyl)-10-oxa-15-azatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6-trien-14-one. InChIKey: DXMFBOLVVHCUHN-QXAKKESOSA-N.
| Molecular formula | C19H16BrNO2 |
|---|---|
| Molecular weight | 370.2 g/mol |
| IUPAC name | (1R,9S,11R)-11-(4-bromophenyl)-10-oxa-15-azatetracyclo[7.6.0.02,7.011,15]pentadeca-2,4,6-trien-14-one |
| InChIKey | DXMFBOLVVHCUHN-QXAKKESOSA-N |
| SMILES | C1C[C@]2(N(C1=O)[C@H]3[C@@H](O2)CC4=CC=CC=C34)C5=CC=C(C=C5)Br |
Computed by PubChem (NCBI)
Synonyms:
NMDA receptor antagonist 5, orb1688565