CAS 2416080-79-8 is the registry number for Rel-1-((1R,5S,6s)-3-oxabicyclo[3.1.0]hexan-6-yl)-3-bromo-1H-pyrrolo[2,3-b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-1-[(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-yl]pyrrolo[2,3-b]pyridine (CAS 2416080-79-8) is a chemical compound with the molecular formula C12H11BrN2O and a molecular weight of 279.13 g/mol. IUPAC name: 3-bromo-1-[(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-yl]pyrrolo[2,3-b]pyridine. InChIKey: MJLUCAIHKLXACS-SLHIUPAKSA-N.
| Molecular formula | C12H11BrN2O |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | 3-bromo-1-[(1S,5R)-3-oxabicyclo[3.1.0]hexan-6-yl]pyrrolo[2,3-b]pyridine |
| InChIKey | MJLUCAIHKLXACS-SLHIUPAKSA-N |
| SMILES | C1[C@@H]2[C@@H](C2N3C=C(C4=C3N=CC=C4)Br)CO1 |
Computed by PubChem (NCBI)