CAS 2416217-51-9 appears in our catalog under these names: ((2R,6S)-Morpholine-2,6-diyl)dimethanol hydrochloride, 98%, 98%, (2S,6R)-Morpholine-2,6-diyldimethanol hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g.
[(2S,6R)-6-(hydroxymethyl)morpholin-2-yl]methanol;hydrochloride (CAS 2416217-51-9) is a chemical compound with the molecular formula C6H14ClNO3 and a molecular weight of 183.63 g/mol. IUPAC name: [(2S,6R)-6-(hydroxymethyl)morpholin-2-yl]methanol;hydrochloride. InChIKey: WEPBNYDWCQRMMC-KNCHESJLSA-N.
| Molecular formula | C6H14ClNO3 |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | [(2S,6R)-6-(hydroxymethyl)morpholin-2-yl]methanol;hydrochloride |
| InChIKey | WEPBNYDWCQRMMC-KNCHESJLSA-N |
| SMILES | C1[C@@H](O[C@@H](CN1)CO)CO.Cl |
Computed by PubChem (NCBI)