Products 2702911-11-1
CAS 2702911-11-1 is the registry number for ((2R,6R)-Morpholine-2,6-diyl)dimethanol hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
[(2R,6R)-6-(hydroxymethyl)morpholin-2-yl]methanol;hydrochloride (CAS 2702911-11-1) is a chemical compound with the molecular formula C6H14ClNO3 and a molecular weight of 183.63 g/mol. IUPAC name: [(2R,6R)-6-(hydroxymethyl)morpholin-2-yl]methanol;hydrochloride. InChIKey: WEPBNYDWCQRMMC-KGZKBUQUSA-N.
| Molecular formula | C6H14ClNO3 |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | [(2R,6R)-6-(hydroxymethyl)morpholin-2-yl]methanol;hydrochloride |
| InChIKey | WEPBNYDWCQRMMC-KGZKBUQUSA-N |
| SMILES | C1[C@@H](O[C@H](CN1)CO)CO.Cl |
Computed by PubChem (NCBI)